C28H23ClFN5O4 — CID 135451803
4-[[2-(chloromethyl)-7-methyl-4-oxo-3H-quinazolin-6-yl]methyl-prop-2-ynylamino]-2-fluoro-N-[(3-nitrophenyl)methyl]benzamide (PubChem CID 135451803) has the molecular formula C28H23ClFN5O4 and a molecular weight of 547.97 g/mol. Its IUPAC name is 4-[[2-(chloromethyl)-7-methyl-4-oxo-3H-quinazolin-6-yl]methyl-prop-2-ynylamino]-2-fluoro-N-[(3-nitrophenyl)methyl]benzamide.
| Compound Name | 4-[[2-(chloromethyl)-7-methyl-4-oxo-3H-quinazolin-6-yl]methyl-prop-2-ynylamino]-2-fluoro-N-[(3-nitrophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 135451803 |
| Molecular Formula | C28H23ClFN5O4 |
| Molecular Weight | 547.97 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 4-[[2-(chloromethyl)-7-methyl-4-oxo-3H-quinazolin-6-yl]methyl-prop-2-ynylamino]-2-fluoro-N-[(3-nitrophenyl)methyl]benzamide |
| SMILES | C#CCN(Cc1cc2c(=O)[nH]c(CCl)nc2cc1C)c1ccc(C(=O)NCc2cccc([N+](=O)[O-])c2)c(F)c1 |
| InChI | InChI=1S/C28H23ClFN5O4/c1-3-9-34(16-19-12-23-25(10-17(19)2)32-26(14-29)33-28(23)37)20-7-8-22(24(30)13-20)27(36)31-15-18-5-4-6-21(11-18)35(38)39/h1,4-8,10-13H,9,14-16H2,2H3,(H,31,36)(H,32,33,37) |
| InChIKey | OHEZJTVYZNFOKH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.97 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|