C25H28FN7O2 — CID 142994944
N-[(4Z)-4-amino-4-hydrazinylidenebutyl]-4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]-2-fluorobenzamide (PubChem CID 142994944) has the molecular formula C25H28FN7O2 and a molecular weight of 477.54 g/mol. Its IUPAC name is N-[(4Z)-4-amino-4-hydrazinylidenebutyl]-4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]-2-fluorobenzamide.
| Compound Name | N-[(4Z)-4-amino-4-hydrazinylidenebutyl]-4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 142994944 |
| Molecular Formula | C25H28FN7O2 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | N-[(4Z)-4-amino-4-hydrazinylidenebutyl]-4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]-2-fluorobenzamide |
| SMILES | C#CCN(Cc1cc2c(=O)[nH]c(C)nc2cc1C)c1ccc(C(=O)NCCC/C(N)=N/N)c(F)c1 |
| InChI | InChI=1S/C25H28FN7O2/c1-4-10-33(14-17-12-20-22(11-15(17)2)30-16(3)31-25(20)35)18-7-8-19(21(26)13-18)24(34)29-9-5-6-23(27)32-28/h1,7-8,11-13H,5-6,9-10,14,28H2,2-3H3,(H2,27,32)(H,29,34)(H,30,31,35) |
| InChIKey | TUQLVWCDZWXIAL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 142.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|