C33H36FN7O4 — CID 135480258
4-[[2-[[2-(dimethylamino)ethyl-methylamino]methyl]-7-methyl-4-oxo-3H-quinazolin-6-yl]methyl-prop-2-ynylamino]-2-fluoro-N-[(3-nitrophenyl)methyl]benzamide (PubChem CID 135480258) has the molecular formula C33H36FN7O4 and a molecular weight of 613.69 g/mol. Its IUPAC name is 4-[[2-[[2-(dimethylamino)ethyl-methylamino]methyl]-7-methyl-4-oxo-3H-quinazolin-6-yl]methyl-prop-2-ynylamino]-2-fluoro-N-[(3-nitrophenyl)methyl]benzamide.
| Compound Name | 4-[[2-[[2-(dimethylamino)ethyl-methylamino]methyl]-7-methyl-4-oxo-3H-quinazolin-6-yl]methyl-prop-2-ynylamino]-2-fluoro-N-[(3-nitrophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 135480258 |
| Molecular Formula | C33H36FN7O4 |
| Molecular Weight | 613.69 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | 4-[[2-[[2-(dimethylamino)ethyl-methylamino]methyl]-7-methyl-4-oxo-3H-quinazolin-6-yl]methyl-prop-2-ynylamino]-2-fluoro-N-[(3-nitrophenyl)methyl]benzamide |
| SMILES | C#CCN(Cc1cc2c(=O)[nH]c(CN(C)CCN(C)C)nc2cc1C)c1ccc(C(=O)NCc2cccc([N+](=O)[O-])c2)c(F)c1 |
| InChI | InChI=1S/C33H36FN7O4/c1-6-12-40(25-10-11-27(29(34)18-25)32(42)35-19-23-8-7-9-26(16-23)41(44)45)20-24-17-28-30(15-22(24)2)36-31(37-33(28)43)21-39(5)14-13-38(3)4/h1,7-11,15-18H,12-14,19-21H2,2-5H3,(H,35,42)(H,36,37,43) |
| InChIKey | ZYKSJLAMYCFPOX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.69 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|