C26H25N5O5 — CID 135994947
4-[2-hydroxyethyl-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]-N-[(3-nitrophenyl)methyl]benzamide (PubChem CID 135994947) has the molecular formula C26H25N5O5 and a molecular weight of 487.52 g/mol. Its IUPAC name is 4-[2-hydroxyethyl-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]-N-[(3-nitrophenyl)methyl]benzamide.
| Compound Name | 4-[2-hydroxyethyl-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]-N-[(3-nitrophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 135994947 |
| Molecular Formula | C26H25N5O5 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 4-[2-hydroxyethyl-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl]amino]-N-[(3-nitrophenyl)methyl]benzamide |
| SMILES | Cc1nc2ccc(CN(CCO)c3ccc(C(=O)NCc4cccc([N+](=O)[O-])c4)cc3)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C26H25N5O5/c1-17-28-24-10-5-19(14-23(24)26(34)29-17)16-30(11-12-32)21-8-6-20(7-9-21)25(33)27-15-18-3-2-4-22(13-18)31(35)36/h2-10,13-14,32H,11-12,15-16H2,1H3,(H,27,33)(H,28,29,34) |
| InChIKey | DHDFIWAJHYQJSQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 141.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|