C16H18N6O4 — CID 135452272
4-(dimethylaminodiazenyl)-N'-[hydroxy-(4-nitrophenyl)methyl]benzohydrazide (PubChem CID 135452272) has the molecular formula C16H18N6O4 and a molecular weight of 358.36 g/mol. Its IUPAC name is 4-(dimethylaminodiazenyl)-N'-[hydroxy-(4-nitrophenyl)methyl]benzohydrazide.
| Compound Name | 4-(dimethylaminodiazenyl)-N'-[hydroxy-(4-nitrophenyl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 135452272 |
| Molecular Formula | C16H18N6O4 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4-(dimethylaminodiazenyl)-N'-[hydroxy-(4-nitrophenyl)methyl]benzohydrazide |
| SMILES | CN(C)/N=N/c1ccc(C(=O)NNC(O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H18N6O4/c1-21(2)20-17-13-7-3-11(4-8-13)15(23)18-19-16(24)12-5-9-14(10-6-12)22(25)26/h3-10,16,19,24H,1-2H3,(H,18,23)/b20-17+ |
| InChIKey | OOSKLCCLAFTJRB-LVZFUZTISA-N |
| XLogP | 2.08 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|