C8H8N4OS — CID 135452310
12-sulfanylidene-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),9-dien-7-one (PubChem CID 135452310) has the molecular formula C8H8N4OS and a molecular weight of 208.25 g/mol. Its IUPAC name is 12-sulfanylidene-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),9-dien-7-one.
| Compound Name | 12-sulfanylidene-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),9-dien-7-one |
|---|---|
| PubChem CID | 135452310 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 12-sulfanylidene-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),9-dien-7-one |
| SMILES | O=c1[nH]c2n[nH]c(=S)n2c2c1CCC2 |
| InChI | InChI=1S/C8H8N4OS/c13-6-4-2-1-3-5(4)12-7(9-6)10-11-8(12)14/h1-3H2,(H,11,14)(H,9,10,13) |
| InChIKey | SVGYSEHYOHATKJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|