C12H10N2O — CID 135452475
5,6-dihydro-3H-benzo[h]quinazolin-4-one (PubChem CID 135452475) has the molecular formula C12H10N2O and a molecular weight of 198.23 g/mol. Its IUPAC name is 5,6-dihydro-3H-benzo[h]quinazolin-4-one.
| Compound Name | 5,6-dihydro-3H-benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 135452475 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 5,6-dihydro-3H-benzo[h]quinazolin-4-one |
| SMILES | O=c1[nH]cnc2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C12H10N2O/c15-12-10-6-5-8-3-1-2-4-9(8)11(10)13-7-14-12/h1-4,7H,5-6H2,(H,13,14,15) |
| InChIKey | UZBYZWOESBBUFB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |