C23H19N3O3 — CID 135452571
3-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 135452571) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 135452571 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | CCOc1cccc(/C=N/n2c(-c3ccccc3)nc3ccccc3c2=O)c1O |
| InChI | InChI=1S/C23H19N3O3/c1-2-29-20-14-8-11-17(21(20)27)15-24-26-22(16-9-4-3-5-10-16)25-19-13-7-6-12-18(19)23(26)28/h3-15,27H,2H2,1H3/b24-15+ |
| InChIKey | FDNSQNRKFABPGL-BUVRLJJBSA-N |
| XLogP | 4.05 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|