C24H19N3O4 — CID 126409391
methyl 2-[2-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetate (PubChem CID 126409391) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is methyl 2-[2-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126409391 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | methyl 2-[2-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1C=Nn1c(-c2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H19N3O4/c1-30-22(28)16-31-21-14-8-5-11-18(21)15-25-27-23(17-9-3-2-4-10-17)26-20-13-7-6-12-19(20)24(27)29/h2-15H,16H2,1H3 |
| InChIKey | RQEKEEQRNSMZOR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|