C12H10N4O4 — CID 135452822
N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 135452822) has the molecular formula C12H10N4O4 and a molecular weight of 274.24 g/mol. Its IUPAC name is N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 135452822 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(O)cc1O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C12H10N4O4/c17-8-2-1-7(10(18)5-8)6-13-16-12(20)9-3-4-11(19)15-14-9/h1-6,17-18H,(H,15,19)(H,16,20)/b13-6- |
| InChIKey | MTPRLPSFYUBLCE-MLPAPPSSSA-N |
| XLogP | -0.05 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|