C11H12N4O — CID 135453550
3-(benzylamino)-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135453550) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 3-(benzylamino)-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(benzylamino)-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135453550 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 3-(benzylamino)-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(NCc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C11H12N4O/c1-8-10(16)13-11(15-14-8)12-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H2,12,13,15,16) |
| InChIKey | WNQCIXTVCHTXGV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |