C12H14N4O — CID 135449193
6-methyl-3-(2-phenylethylamino)-4H-1,2,4-triazin-5-one (PubChem CID 135449193) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 6-methyl-3-(2-phenylethylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-methyl-3-(2-phenylethylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135449193 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 6-methyl-3-(2-phenylethylamino)-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(NCCc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C12H14N4O/c1-9-11(17)14-12(16-15-9)13-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H2,13,14,16,17) |
| InChIKey | DMKPLKFQNBYLAC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |