C12H14N4O2 — CID 135515371
6-benzyl-3-(2-hydroxyethylamino)-4H-1,2,4-triazin-5-one (PubChem CID 135515371) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 6-benzyl-3-(2-hydroxyethylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-benzyl-3-(2-hydroxyethylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135515371 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 6-benzyl-3-(2-hydroxyethylamino)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(NCCO)nnc1Cc1ccccc1 |
| InChI | InChI=1S/C12H14N4O2/c17-7-6-13-12-14-11(18)10(15-16-12)8-9-4-2-1-3-5-9/h1-5,17H,6-8H2,(H2,13,14,16,18) |
| InChIKey | YUUQROBENAJVFK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |