C13H16N4O2 — CID 135652589
6-benzyl-3-(2-methoxyethylamino)-4H-1,2,4-triazin-5-one (PubChem CID 135652589) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 6-benzyl-3-(2-methoxyethylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-benzyl-3-(2-methoxyethylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135652589 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 6-benzyl-3-(2-methoxyethylamino)-4H-1,2,4-triazin-5-one |
| SMILES | COCCNc1nnc(Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H16N4O2/c1-19-8-7-14-13-15-12(18)11(16-17-13)9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H2,14,15,17,18) |
| InChIKey | JKVWWESBQIDJIF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|