C13H13FN4O — CID 135561173
6-[(4-fluorophenyl)methyl]-3-(prop-2-enylamino)-4H-1,2,4-triazin-5-one (PubChem CID 135561173) has the molecular formula C13H13FN4O and a molecular weight of 260.27 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-3-(prop-2-enylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-[(4-fluorophenyl)methyl]-3-(prop-2-enylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135561173 |
| Molecular Formula | C13H13FN4O |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-3-(prop-2-enylamino)-4H-1,2,4-triazin-5-one |
| SMILES | C=CCNc1nnc(Cc2ccc(F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H13FN4O/c1-2-7-15-13-16-12(19)11(17-18-13)8-9-3-5-10(14)6-4-9/h2-6H,1,7-8H2,(H2,15,16,18,19) |
| InChIKey | ARCICKILUPONRD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|