C25H19N3O4 — CID 135454230
2,4-dihydroxy-6-oxo-N,1-diphenyl-N-(phenyliminomethyl)pyridine-3-carboxamide (PubChem CID 135454230) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is 2,4-dihydroxy-6-oxo-N,1-diphenyl-N-(phenyliminomethyl)pyridine-3-carboxamide.
| Compound Name | 2,4-dihydroxy-6-oxo-N,1-diphenyl-N-(phenyliminomethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135454230 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2,4-dihydroxy-6-oxo-N,1-diphenyl-N-(phenyliminomethyl)pyridine-3-carboxamide |
| SMILES | O=C(c1c(O)cc(=O)n(-c2ccccc2)c1O)N(/C=N/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H19N3O4/c29-21-16-22(30)28(20-14-8-3-9-15-20)25(32)23(21)24(31)27(19-12-6-2-7-13-19)17-26-18-10-4-1-5-11-18/h1-17,29,32H/b26-17+ |
| InChIKey | RZMQMGWEOGVTJL-YZSQISJMSA-N |
| XLogP | 4.26 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|