C16H22N6O3 — CID 135464197
8-methyl-5-(piperazine-1-carbonyl)-4,6,8,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),5-diene-3,9-dione (PubChem CID 135464197) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 8-methyl-5-(piperazine-1-carbonyl)-4,6,8,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),5-diene-3,9-dione.
| Compound Name | 8-methyl-5-(piperazine-1-carbonyl)-4,6,8,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),5-diene-3,9-dione |
|---|---|
| PubChem CID | 135464197 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 8-methyl-5-(piperazine-1-carbonyl)-4,6,8,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),5-diene-3,9-dione |
| SMILES | CN1C(=O)N2CCCCC2c2c1nc(C(=O)N1CCNCC1)[nH]c2=O |
| InChI | InChI=1S/C16H22N6O3/c1-20-13-11(10-4-2-3-7-22(10)16(20)25)14(23)19-12(18-13)15(24)21-8-5-17-6-9-21/h10,17H,2-9H2,1H3,(H,18,19,23) |
| InChIKey | AOEFWGRDWFNZSP-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |