C14H19N5O3 — CID 135492436
N,N,8-trimethyl-3,9-dioxo-4,6,8,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),5-diene-5-carboxamide (PubChem CID 135492436) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is N,N,8-trimethyl-3,9-dioxo-4,6,8,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),5-diene-5-carboxamide.
| Compound Name | N,N,8-trimethyl-3,9-dioxo-4,6,8,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),5-diene-5-carboxamide |
|---|---|
| PubChem CID | 135492436 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N,N,8-trimethyl-3,9-dioxo-4,6,8,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),5-diene-5-carboxamide |
| SMILES | CN(C)C(=O)c1nc2c(c(=O)[nH]1)C1CCCCN1C(=O)N2C |
| InChI | InChI=1S/C14H19N5O3/c1-17(2)13(21)10-15-11-9(12(20)16-10)8-6-4-5-7-19(8)14(22)18(11)3/h8H,4-7H2,1-3H3,(H,15,16,20) |
| InChIKey | VUEQSRWOCGDYKR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |