C19H27N5O3 — CID 135492572
8-butyl-5-(pyrrolidine-1-carbonyl)-4,6,8,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),5-diene-3,9-dione (PubChem CID 135492572) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 8-butyl-5-(pyrrolidine-1-carbonyl)-4,6,8,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),5-diene-3,9-dione.
| Compound Name | 8-butyl-5-(pyrrolidine-1-carbonyl)-4,6,8,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),5-diene-3,9-dione |
|---|---|
| PubChem CID | 135492572 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 8-butyl-5-(pyrrolidine-1-carbonyl)-4,6,8,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),5-diene-3,9-dione |
| SMILES | CCCCN1C(=O)N2CCCCC2c2c1nc(C(=O)N1CCCC1)[nH]c2=O |
| InChI | InChI=1S/C19H27N5O3/c1-2-3-11-24-16-14(13-8-4-5-12-23(13)19(24)27)17(25)21-15(20-16)18(26)22-9-6-7-10-22/h13H,2-12H2,1H3,(H,20,21,25) |
| InChIKey | IDBJWJOFTPXCLZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |