C23H19N3O — CID 135464675
2-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol (PubChem CID 135464675) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol.
| Compound Name | 2-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135464675 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol |
| SMILES | Cc1nn(-c2ccccc2)c(/N=C/c2ccccc2O)c1-c1ccccc1 |
| InChI | InChI=1S/C23H19N3O/c1-17-22(18-10-4-2-5-11-18)23(24-16-19-12-8-9-15-21(19)27)26(25-17)20-13-6-3-7-14-20/h2-16,27H,1H3/b24-16+ |
| InChIKey | ZKGPVVHWUJZKMN-LFVJCYFKSA-N |
| XLogP | 5.30 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|