C32H25N3O9S — CID 135470471
dimethyl (E)-2-(4-methoxycarbonyl-6-oxo-2-phenylpyran-3-yl)-3-[1-(3-methyl-[1,3]thiazolo[3,2-c]triazol-2-ium-2-yl)-2-oxo-2-phenylethyl]but-2-enedioate (PubChem CID 135470471) has the molecular formula C32H25N3O9S and a molecular weight of 627.63 g/mol. Its IUPAC name is dimethyl (E)-2-(4-methoxycarbonyl-6-oxo-2-phenylpyran-3-yl)-3-[1-(3-methyl-[1,3]thiazolo[3,2-c]triazol-2-ium-2-yl)-2-oxo-2-phenylethyl]but-2-enedioate.
| Compound Name | dimethyl (E)-2-(4-methoxycarbonyl-6-oxo-2-phenylpyran-3-yl)-3-[1-(3-methyl-[1,3]thiazolo[3,2-c]triazol-2-ium-2-yl)-2-oxo-2-phenylethyl]but-2-enedioate |
|---|---|
| PubChem CID | 135470471 |
| Molecular Formula | C32H25N3O9S |
| Molecular Weight | 627.63 g/mol |
| Exact Mass | 627.13 |
| IUPAC Name | dimethyl (E)-2-(4-methoxycarbonyl-6-oxo-2-phenylpyran-3-yl)-3-[1-(3-methyl-[1,3]thiazolo[3,2-c]triazol-2-ium-2-yl)-2-oxo-2-phenylethyl]but-2-enedioate |
| SMILES | COC(=O)/C(=C(/C(=O)OC)[C-](C(=O)c1ccccc1)[n+]1nn2ccsc2c1C)c1c(C(=O)OC)cc(=O)oc1-c1ccccc1 |
| InChI | InChI=1S/C32H25N3O9S/c1-18-29-34(15-16-45-29)33-35(18)26(27(37)19-11-7-5-8-12-19)25(32(40)43-4)24(31(39)42-3)23-21(30(38)41-2)17-22(36)44-28(23)20-13-9-6-10-14-20/h5-17H,1-4H3/b25-24+,35-26- |
| InChIKey | NJRWCKBYTCZKGF-QFZFBKMTSA-N |
| XLogP | 3.46 |
| TPSA | 147.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|