C22H16N4O6 — CID 135474677
2-[2-[2,4-dihydroxy-5-[(4-nitrophenyl)diazenyl]phenyl]ethyl]isoindole-1,3-dione (PubChem CID 135474677) has the molecular formula C22H16N4O6 and a molecular weight of 432.39 g/mol. Its IUPAC name is 2-[2-[2,4-dihydroxy-5-[(4-nitrophenyl)diazenyl]phenyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2,4-dihydroxy-5-[(4-nitrophenyl)diazenyl]phenyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135474677 |
| Molecular Formula | C22H16N4O6 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-[2-[2,4-dihydroxy-5-[(4-nitrophenyl)diazenyl]phenyl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1cc(/N=N/c2ccc([N+](=O)[O-])cc2)c(O)cc1O |
| InChI | InChI=1S/C22H16N4O6/c27-19-12-20(28)18(24-23-14-5-7-15(8-6-14)26(31)32)11-13(19)9-10-25-21(29)16-3-1-2-4-17(16)22(25)30/h1-8,11-12,27-28H,9-10H2/b24-23+ |
| InChIKey | MRUANCWHSUMEQL-WCWDXBQESA-N |
| XLogP | 4.26 |
| TPSA | 145.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|