C5H4N4OS — CID 135474990
6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135474990) has the molecular formula C5H4N4OS and a molecular weight of 168.18 g/mol. Its IUPAC name is 6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135474990 |
| Molecular Formula | C5H4N4OS |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2[nH]ncc12 |
| InChI | InChI=1S/C5H4N4OS/c10-4-2-1-6-9-3(2)7-5(11)8-4/h1H,(H3,6,7,8,9,10,11) |
| InChIKey | SXRSXYWROQWSGJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|