C5H4N4S2 — CID 135523674
1,7-dihydropyrazolo[5,4-d]pyrimidine-4,6-dithione (PubChem CID 135523674) has the molecular formula C5H4N4S2 and a molecular weight of 184.25 g/mol. Its IUPAC name is 1,7-dihydropyrazolo[5,4-d]pyrimidine-4,6-dithione.
| Compound Name | 1,7-dihydropyrazolo[5,4-d]pyrimidine-4,6-dithione |
|---|---|
| PubChem CID | 135523674 |
| Molecular Formula | C5H4N4S2 |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | 1,7-dihydropyrazolo[5,4-d]pyrimidine-4,6-dithione |
| SMILES | S=c1[nH]c(=S)c2cn[nH]c2[nH]1 |
| InChI | InChI=1S/C5H4N4S2/c10-4-2-1-6-9-3(2)7-5(11)8-4/h1H,(H3,6,7,8,9,10,11) |
| InChIKey | AXTGUDOELRNMOD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|