C16H15BrN4O3S — CID 135475005
ethyl N-[4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]carbamate (PubChem CID 135475005) has the molecular formula C16H15BrN4O3S and a molecular weight of 423.29 g/mol. Its IUPAC name is ethyl N-[4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]carbamate.
| Compound Name | ethyl N-[4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]carbamate |
|---|---|
| PubChem CID | 135475005 |
| Molecular Formula | C16H15BrN4O3S |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | ethyl N-[4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]carbamate |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(Br)cc3)cs2)=C(O)CN1NC(=O)OCC |
| InChI | InChI=1S/C16H15BrN4O3S/c1-2-24-16(23)20-21-7-12(22)13(14(21)18)15-19-11(8-25-15)9-3-5-10(17)6-4-9/h3-6,8,18,22H,2,7H2,1H3,(H,20,23)/b18-14- |
| InChIKey | WPQXOFLSZVFECT-JXAWBTAJSA-N |
| XLogP | 3.80 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|