C20H14ClN5O4S — CID 135409840
N-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]-2-nitrobenzamide (PubChem CID 135409840) has the molecular formula C20H14ClN5O4S and a molecular weight of 455.88 g/mol. Its IUPAC name is N-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]-2-nitrobenzamide.
| Compound Name | N-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 135409840 |
| Molecular Formula | C20H14ClN5O4S |
| Molecular Weight | 455.88 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | N-[4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]-2-nitrobenzamide |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(Cl)cc3)cs2)=C(O)CN1NC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H14ClN5O4S/c21-12-7-5-11(6-8-12)14-10-31-20(23-14)17-16(27)9-25(18(17)22)24-19(28)13-3-1-2-4-15(13)26(29)30/h1-8,10,22,27H,9H2,(H,24,28)/b22-18- |
| InChIKey | XGLMZVPBWOHFRB-PYCFMQQDSA-N |
| XLogP | 4.28 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.88 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|