C22H19N5O6S — CID 135437196
N-[3-hydroxy-5-imino-4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2H-pyrrol-1-yl]-3,4-dimethoxybenzamide (PubChem CID 135437196) has the molecular formula C22H19N5O6S and a molecular weight of 481.49 g/mol. Its IUPAC name is N-[3-hydroxy-5-imino-4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2H-pyrrol-1-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[3-hydroxy-5-imino-4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2H-pyrrol-1-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 135437196 |
| Molecular Formula | C22H19N5O6S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-[3-hydroxy-5-imino-4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2H-pyrrol-1-yl]-3,4-dimethoxybenzamide |
| SMILES | [H]/N=C1/C(c2nc(-c3cccc([N+](=O)[O-])c3)cs2)=C(O)CN1NC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H19N5O6S/c1-32-17-7-6-13(9-18(17)33-2)21(29)25-26-10-16(28)19(20(26)23)22-24-15(11-34-22)12-4-3-5-14(8-12)27(30)31/h3-9,11,23,28H,10H2,1-2H3,(H,25,29)/b23-20- |
| InChIKey | ZEFAEJGKCYJOLB-ATJXCDBQSA-N |
| XLogP | 3.64 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|