C52H44N2NiO2+2 — CID 135480457
(Z)-4-[2-[[(Z)-4-hydroxy-1,5-dinaphthalen-1-ylpent-3-en-2-ylidene]amino]ethylimino]-1,5-dinaphthalen-1-ylpent-2-en-2-ol;nickel(2+) (PubChem CID 135480457) has the molecular formula C52H44N2NiO2+2 and a molecular weight of 787.63 g/mol. Its IUPAC name is (Z)-4-[2-[[(Z)-4-hydroxy-1,5-dinaphthalen-1-ylpent-3-en-2-ylidene]amino]ethylimino]-1,5-dinaphthalen-1-ylpent-2-en-2-ol;nickel(2+).
| Compound Name | (Z)-4-[2-[[(Z)-4-hydroxy-1,5-dinaphthalen-1-ylpent-3-en-2-ylidene]amino]ethylimino]-1,5-dinaphthalen-1-ylpent-2-en-2-ol;nickel(2+) |
|---|---|
| PubChem CID | 135480457 |
| Molecular Formula | C52H44N2NiO2+2 |
| Molecular Weight | 787.63 g/mol |
| Exact Mass | 786.27 |
| IUPAC Name | (Z)-4-[2-[[(Z)-4-hydroxy-1,5-dinaphthalen-1-ylpent-3-en-2-ylidene]amino]ethylimino]-1,5-dinaphthalen-1-ylpent-2-en-2-ol;nickel(2+) |
| SMILES | O/C(=C\C(Cc1cccc2ccccc12)=N/CC/N=C(\C=C(/O)Cc1cccc2ccccc12)Cc1cccc2ccccc12)Cc1cccc2ccccc12.[Ni+2] |
| InChI | InChI=1S/C52H44N2O2.Ni/c55-47(33-43-23-11-19-39-15-3-7-27-51(39)43)35-45(31-41-21-9-17-37-13-1-5-25-49(37)41)53-29-30-54-46(32-42-22-10-18-38-14-2-6-26-50(38)42)36-48(56)34-44-24-12-20-40-16-4-8-28-52(40)44;/h1-28,35-36,55-56H,29-34H2;/q;+2/b47-35-,48-36-,53-45-,54-46-; |
| InChIKey | GHRXAQUEILVCTM-BANSHQCASA-N |
| XLogP | 12.33 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.63 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|