C36H36CuN2O2+2 — CID 135501189
copper (Z)-4-[2-[[(Z)-4-hydroxy-1,5-diphenylpent-3-en-2-ylidene]amino]ethylimino]-1,5-diphenylpent-2-en-2-ol (PubChem CID 135501189) has the molecular formula C36H36CuN2O2+2 and a molecular weight of 592.24 g/mol. Its IUPAC name is copper (Z)-4-[2-[[(Z)-4-hydroxy-1,5-diphenylpent-3-en-2-ylidene]amino]ethylimino]-1,5-diphenylpent-2-en-2-ol.
| Compound Name | copper (Z)-4-[2-[[(Z)-4-hydroxy-1,5-diphenylpent-3-en-2-ylidene]amino]ethylimino]-1,5-diphenylpent-2-en-2-ol |
|---|---|
| PubChem CID | 135501189 |
| Molecular Formula | C36H36CuN2O2+2 |
| Molecular Weight | 592.24 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | copper (Z)-4-[2-[[(Z)-4-hydroxy-1,5-diphenylpent-3-en-2-ylidene]amino]ethylimino]-1,5-diphenylpent-2-en-2-ol |
| SMILES | O/C(=C\C(Cc1ccccc1)=N/CC/N=C(\C=C(/O)Cc1ccccc1)Cc1ccccc1)Cc1ccccc1.[Cu+2] |
| InChI | InChI=1S/C36H36N2O2.Cu/c39-35(25-31-17-9-3-10-18-31)27-33(23-29-13-5-1-6-14-29)37-21-22-38-34(24-30-15-7-2-8-16-30)28-36(40)26-32-19-11-4-12-20-32;/h1-20,27-28,39-40H,21-26H2;/q;+2/b35-27-,36-28-,37-33-,38-34-; |
| InChIKey | XNUOTQNRXWWJRJ-WSTLXRCVSA-N |
| XLogP | 7.72 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.24 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|