C32H32N2O2 — CID 176730859
2-[4-[(2-hydroxy-1,2-diphenylethylidene)amino]butylimino]-1,2-diphenylethanol (PubChem CID 176730859) has the molecular formula C32H32N2O2 and a molecular weight of 476.62 g/mol. Its IUPAC name is 2-[4-[(2-hydroxy-1,2-diphenylethylidene)amino]butylimino]-1,2-diphenylethanol.
| Compound Name | 2-[4-[(2-hydroxy-1,2-diphenylethylidene)amino]butylimino]-1,2-diphenylethanol |
|---|---|
| PubChem CID | 176730859 |
| Molecular Formula | C32H32N2O2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 2-[4-[(2-hydroxy-1,2-diphenylethylidene)amino]butylimino]-1,2-diphenylethanol |
| SMILES | OC(/C(=N\CCCC/N=C(\c1ccccc1)C(O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H32N2O2/c35-31(27-19-9-3-10-20-27)29(25-15-5-1-6-16-25)33-23-13-14-24-34-30(26-17-7-2-8-18-26)32(36)28-21-11-4-12-22-28/h1-12,15-22,31-32,35-36H,13-14,23-24H2/b33-29-,34-30+ |
| InChIKey | DCENOECBNNNGSJ-HKQZHLORSA-N |
| XLogP | 6.21 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|