C31H30N2O3 — CID 176730860
1,3-bis[(2-hydroxy-1,2-diphenylethylidene)amino]propan-2-ol (PubChem CID 176730860) has the molecular formula C31H30N2O3 and a molecular weight of 478.59 g/mol. Its IUPAC name is 1,3-bis[(2-hydroxy-1,2-diphenylethylidene)amino]propan-2-ol.
| Compound Name | 1,3-bis[(2-hydroxy-1,2-diphenylethylidene)amino]propan-2-ol |
|---|---|
| PubChem CID | 176730860 |
| Molecular Formula | C31H30N2O3 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 1,3-bis[(2-hydroxy-1,2-diphenylethylidene)amino]propan-2-ol |
| SMILES | OC(C/N=C(/c1ccccc1)C(O)c1ccccc1)C/N=C(\c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C31H30N2O3/c34-27(21-32-28(23-13-5-1-6-14-23)30(35)25-17-9-3-10-18-25)22-33-29(24-15-7-2-8-16-24)31(36)26-19-11-4-12-20-26/h1-20,27,30-31,34-36H,21-22H2/b32-28-,33-29+ |
| InChIKey | OGGCEYYZUXTXKO-VPROMNBDSA-N |
| XLogP | 4.79 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|