C39H38N2O4 — CID 135526227
2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-[2-[[2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-oxocyclohexylidene]amino]propylimino]cyclohexan-1-one (PubChem CID 135526227) has the molecular formula C39H38N2O4 and a molecular weight of 598.74 g/mol. Its IUPAC name is 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-[2-[[2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-oxocyclohexylidene]amino]propylimino]cyclohexan-1-one.
| Compound Name | 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-[2-[[2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-oxocyclohexylidene]amino]propylimino]cyclohexan-1-one |
|---|---|
| PubChem CID | 135526227 |
| Molecular Formula | C39H38N2O4 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-[2-[[2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-oxocyclohexylidene]amino]propylimino]cyclohexan-1-one |
| SMILES | CC(C/N=C1/CCCC(=O)C1=C(O)Cc1cccc2ccccc12)/N=C1\CCCC(=O)C1=C(O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C39H38N2O4/c1-25(41-33-19-9-21-35(43)39(33)37(45)23-29-15-7-13-27-11-3-5-17-31(27)29)24-40-32-18-8-20-34(42)38(32)36(44)22-28-14-6-12-26-10-2-4-16-30(26)28/h2-7,10-17,25,44-45H,8-9,18-24H2,1H3/b38-36?,39-37?,40-32-,41-33+ |
| InChIKey | GAANMPXSTIJBAS-SSLGMADQSA-N |
| XLogP | 8.18 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|