C19H21Cl2FN6O — CID 135481001
5-chloro-6-(2-chloro-4-fluorophenyl)-7-(3,3-dimethylbutan-2-ylamino)-N'-hydroxypyrazolo[1,5-a]pyrimidine-3-carboximidamide (PubChem CID 135481001) has the molecular formula C19H21Cl2FN6O and a molecular weight of 439.32 g/mol. Its IUPAC name is 5-chloro-6-(2-chloro-4-fluorophenyl)-7-(3,3-dimethylbutan-2-ylamino)-N'-hydroxypyrazolo[1,5-a]pyrimidine-3-carboximidamide.
| Compound Name | 5-chloro-6-(2-chloro-4-fluorophenyl)-7-(3,3-dimethylbutan-2-ylamino)-N'-hydroxypyrazolo[1,5-a]pyrimidine-3-carboximidamide |
|---|---|
| PubChem CID | 135481001 |
| Molecular Formula | C19H21Cl2FN6O |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 5-chloro-6-(2-chloro-4-fluorophenyl)-7-(3,3-dimethylbutan-2-ylamino)-N'-hydroxypyrazolo[1,5-a]pyrimidine-3-carboximidamide |
| SMILES | CC(Nc1c(-c2ccc(F)cc2Cl)c(Cl)nc2c(/C(N)=N\O)cnn12)C(C)(C)C |
| InChI | InChI=1S/C19H21Cl2FN6O/c1-9(19(2,3)4)25-18-14(11-6-5-10(22)7-13(11)20)15(21)26-17-12(16(23)27-29)8-24-28(17)18/h5-9,25,29H,1-4H3,(H2,23,27) |
| InChIKey | PGGTXTIGSYBCBS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|