C18H25N5O — CID 135487277
6-benzyl-3-[(2E)-2-octylidenehydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 135487277) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 6-benzyl-3-[(2E)-2-octylidenehydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-benzyl-3-[(2E)-2-octylidenehydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135487277 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 6-benzyl-3-[(2E)-2-octylidenehydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | CCCCCCC/C=N/Nc1nnc(Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H25N5O/c1-2-3-4-5-6-10-13-19-22-18-20-17(24)16(21-23-18)14-15-11-8-7-9-12-15/h7-9,11-13H,2-6,10,14H2,1H3,(H2,20,22,23,24)/b19-13+ |
| InChIKey | GOYDAAIMPZHDCU-CPNJWEJPSA-N |
| XLogP | 3.51 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|