C31H28N4O7S — CID 135488612
ethyl 5-(3,4-dimethoxyphenyl)-2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-7-phenyl-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 135488612) has the molecular formula C31H28N4O7S and a molecular weight of 600.65 g/mol. Its IUPAC name is ethyl 5-(3,4-dimethoxyphenyl)-2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-7-phenyl-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-(3,4-dimethoxyphenyl)-2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-7-phenyl-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135488612 |
| Molecular Formula | C31H28N4O7S |
| Molecular Weight | 600.65 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | ethyl 5-(3,4-dimethoxyphenyl)-2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-7-phenyl-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)Nc2nc(SCc3ccc([N+](=O)[O-])cc3)[nH]c(=O)c2C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C31H28N4O7S/c1-4-42-30(37)25-24(20-12-15-22(40-2)23(16-20)41-3)26-28(32-27(25)19-8-6-5-7-9-19)33-31(34-29(26)36)43-17-18-10-13-21(14-11-18)35(38)39/h5-16,24H,4,17H2,1-3H3,(H2,32,33,34,36) |
| InChIKey | QEDZSPIJGJGYES-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|