C31H28N4O6S — CID 135519622
ethyl 7-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-5-(4-phenylmethoxyphenyl)-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 135519622) has the molecular formula C31H28N4O6S and a molecular weight of 584.65 g/mol. Its IUPAC name is ethyl 7-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-5-(4-phenylmethoxyphenyl)-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-5-(4-phenylmethoxyphenyl)-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135519622 |
| Molecular Formula | C31H28N4O6S |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | ethyl 7-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-5-(4-phenylmethoxyphenyl)-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(SCc3ccc([N+](=O)[O-])cc3)[nH]c(=O)c2C1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H28N4O6S/c1-3-40-30(37)25-19(2)32-28-27(26(25)22-11-15-24(16-12-22)41-17-20-7-5-4-6-8-20)29(36)34-31(33-28)42-18-21-9-13-23(14-10-21)35(38)39/h4-16,26H,3,17-18H2,1-2H3,(H2,32,33,34,36) |
| InChIKey | HOVJJLXPUMPQIV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|