C28H23N5O5S — CID 135760938
ethyl 2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-7-phenyl-5-pyridin-2-yl-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 135760938) has the molecular formula C28H23N5O5S and a molecular weight of 541.59 g/mol. Its IUPAC name is ethyl 2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-7-phenyl-5-pyridin-2-yl-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-7-phenyl-5-pyridin-2-yl-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135760938 |
| Molecular Formula | C28H23N5O5S |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | ethyl 2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-7-phenyl-5-pyridin-2-yl-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)Nc2nc(SCc3ccc([N+](=O)[O-])cc3)[nH]c(=O)c2C1c1ccccn1 |
| InChI | InChI=1S/C28H23N5O5S/c1-2-38-27(35)22-21(20-10-6-7-15-29-20)23-25(30-24(22)18-8-4-3-5-9-18)31-28(32-26(23)34)39-16-17-11-13-19(14-12-17)33(36)37/h3-15,21H,2,16H2,1H3,(H2,30,31,32,34) |
| InChIKey | GDRKOSZFFNOEKT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|