C23H21N5O5S — CID 135723358
ethyl 7-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-5-pyridin-2-yl-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 135723358) has the molecular formula C23H21N5O5S and a molecular weight of 479.52 g/mol. Its IUPAC name is ethyl 7-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-5-pyridin-2-yl-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-5-pyridin-2-yl-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135723358 |
| Molecular Formula | C23H21N5O5S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | ethyl 7-methyl-2-[(4-nitrophenyl)methylsulfanyl]-4-oxo-5-pyridin-2-yl-5,8-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(SCc3ccc([N+](=O)[O-])cc3)[nH]c(=O)c2C1c1ccccn1 |
| InChI | InChI=1S/C23H21N5O5S/c1-3-33-22(30)17-13(2)25-20-19(18(17)16-6-4-5-11-24-16)21(29)27-23(26-20)34-12-14-7-9-15(10-8-14)28(31)32/h4-11,18H,3,12H2,1-2H3,(H2,25,26,27,29) |
| InChIKey | OWAWVVYQBRZKCQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|