C14H14N6O4 — CID 135491109
N,N-dimethylformamide;8-(3-nitrophenyl)-1,7-dihydropurin-6-one (PubChem CID 135491109) has the molecular formula C14H14N6O4 and a molecular weight of 330.30 g/mol. Its IUPAC name is N,N-dimethylformamide;8-(3-nitrophenyl)-1,7-dihydropurin-6-one.
| Compound Name | N,N-dimethylformamide;8-(3-nitrophenyl)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135491109 |
| Molecular Formula | C14H14N6O4 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N,N-dimethylformamide;8-(3-nitrophenyl)-1,7-dihydropurin-6-one |
| SMILES | CN(C)C=O.O=c1[nH]cnc2nc(-c3cccc([N+](=O)[O-])c3)[nH]c12 |
| InChI | InChI=1S/C11H7N5O3.C3H7NO/c17-11-8-10(12-5-13-11)15-9(14-8)6-2-1-3-7(4-6)16(18)19;1-4(2)3-5/h1-5H,(H2,12,13,14,15,17);3H,1-2H3 |
| InChIKey | JPINKRQKITXCOQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 137.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|