C12H8N6O3 — CID 135891444
2-[(3-nitrophenyl)methylideneamino]-1,7-dihydropurin-6-one (PubChem CID 135891444) has the molecular formula C12H8N6O3 and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-[(3-nitrophenyl)methylideneamino]-1,7-dihydropurin-6-one.
| Compound Name | 2-[(3-nitrophenyl)methylideneamino]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135891444 |
| Molecular Formula | C12H8N6O3 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-[(3-nitrophenyl)methylideneamino]-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(N=Cc2cccc([N+](=O)[O-])c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H8N6O3/c19-11-9-10(15-6-14-9)16-12(17-11)13-5-7-2-1-3-8(4-7)18(20)21/h1-6H,(H2,14,15,16,17,19) |
| InChIKey | QKOYAJUMZMNFDU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|