C19H13F6NO3 — CID 135492645
1,1,1-trifluoro-4-hydroxy-4-(4-methoxyphenyl)-3-[[3-(trifluoromethyl)phenyl]iminomethyl]but-3-en-2-one (PubChem CID 135492645) has the molecular formula C19H13F6NO3 and a molecular weight of 417.31 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-hydroxy-4-(4-methoxyphenyl)-3-[[3-(trifluoromethyl)phenyl]iminomethyl]but-3-en-2-one.
| Compound Name | 1,1,1-trifluoro-4-hydroxy-4-(4-methoxyphenyl)-3-[[3-(trifluoromethyl)phenyl]iminomethyl]but-3-en-2-one |
|---|---|
| PubChem CID | 135492645 |
| Molecular Formula | C19H13F6NO3 |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 1,1,1-trifluoro-4-hydroxy-4-(4-methoxyphenyl)-3-[[3-(trifluoromethyl)phenyl]iminomethyl]but-3-en-2-one |
| SMILES | COc1ccc(C(O)=C(/C=N/c2cccc(C(F)(F)F)c2)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H13F6NO3/c1-29-14-7-5-11(6-8-14)16(27)15(17(28)19(23,24)25)10-26-13-4-2-3-12(9-13)18(20,21)22/h2-10,27H,1H3/b16-15?,26-10+ |
| InChIKey | GLXHMVIMSJOSQF-ONCDZVLPSA-N |
| XLogP | 5.52 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|