C18H13F4NO3 — CID 135496700
1,1,1-trifluoro-3-[(2-fluorophenyl)iminomethyl]-4-hydroxy-4-(4-methoxyphenyl)but-3-en-2-one (PubChem CID 135496700) has the molecular formula C18H13F4NO3 and a molecular weight of 367.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[(2-fluorophenyl)iminomethyl]-4-hydroxy-4-(4-methoxyphenyl)but-3-en-2-one.
| Compound Name | 1,1,1-trifluoro-3-[(2-fluorophenyl)iminomethyl]-4-hydroxy-4-(4-methoxyphenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 135496700 |
| Molecular Formula | C18H13F4NO3 |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 1,1,1-trifluoro-3-[(2-fluorophenyl)iminomethyl]-4-hydroxy-4-(4-methoxyphenyl)but-3-en-2-one |
| SMILES | COc1ccc(C(O)=C(/C=N/c2ccccc2F)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H13F4NO3/c1-26-12-8-6-11(7-9-12)16(24)13(17(25)18(20,21)22)10-23-15-5-3-2-4-14(15)19/h2-10,24H,1H3/b16-13?,23-10+ |
| InChIKey | IQDFLCRVFYBPEC-SJXNDZCBSA-N |
| XLogP | 4.64 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|