C15H10F3NO2S — CID 135450480
(Z)-1,1,1-trifluoro-4-hydroxy-3-(phenyliminomethyl)-4-thiophen-2-ylbut-3-en-2-one (PubChem CID 135450480) has the molecular formula C15H10F3NO2S and a molecular weight of 325.31 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-hydroxy-3-(phenyliminomethyl)-4-thiophen-2-ylbut-3-en-2-one.
| Compound Name | (Z)-1,1,1-trifluoro-4-hydroxy-3-(phenyliminomethyl)-4-thiophen-2-ylbut-3-en-2-one |
|---|---|
| PubChem CID | 135450480 |
| Molecular Formula | C15H10F3NO2S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-hydroxy-3-(phenyliminomethyl)-4-thiophen-2-ylbut-3-en-2-one |
| SMILES | O=C(C(/C=N/c1ccccc1)=C(\O)c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C15H10F3NO2S/c16-15(17,18)14(21)11(13(20)12-7-4-8-22-12)9-19-10-5-2-1-3-6-10/h1-9,20H/b13-11-,19-9+ |
| InChIKey | VSFNTYRRYJCGIW-LCWOCYRDSA-N |
| XLogP | 4.55 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|