C16H9F6NO2S — CID 135514812
1,1,1-trifluoro-4-hydroxy-4-thiophen-2-yl-3-[[3-(trifluoromethyl)phenyl]iminomethyl]but-3-en-2-one (PubChem CID 135514812) has the molecular formula C16H9F6NO2S and a molecular weight of 393.31 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-hydroxy-4-thiophen-2-yl-3-[[3-(trifluoromethyl)phenyl]iminomethyl]but-3-en-2-one.
| Compound Name | 1,1,1-trifluoro-4-hydroxy-4-thiophen-2-yl-3-[[3-(trifluoromethyl)phenyl]iminomethyl]but-3-en-2-one |
|---|---|
| PubChem CID | 135514812 |
| Molecular Formula | C16H9F6NO2S |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 1,1,1-trifluoro-4-hydroxy-4-thiophen-2-yl-3-[[3-(trifluoromethyl)phenyl]iminomethyl]but-3-en-2-one |
| SMILES | O=C(C(/C=N/c1cccc(C(F)(F)F)c1)=C(O)c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C16H9F6NO2S/c17-15(18,19)9-3-1-4-10(7-9)23-8-11(14(25)16(20,21)22)13(24)12-5-2-6-26-12/h1-8,24H/b13-11?,23-8+ |
| InChIKey | OZSMMBMAKSDOEP-PIDJQUGRSA-N |
| XLogP | 5.57 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|