C15H9BrF3NO2S — CID 135759931
(E)-3-[(4-bromophenyl)iminomethyl]-1,1,1-trifluoro-4-hydroxy-4-thiophen-2-ylbut-3-en-2-one (PubChem CID 135759931) has the molecular formula C15H9BrF3NO2S and a molecular weight of 404.21 g/mol. Its IUPAC name is (E)-3-[(4-bromophenyl)iminomethyl]-1,1,1-trifluoro-4-hydroxy-4-thiophen-2-ylbut-3-en-2-one.
| Compound Name | (E)-3-[(4-bromophenyl)iminomethyl]-1,1,1-trifluoro-4-hydroxy-4-thiophen-2-ylbut-3-en-2-one |
|---|---|
| PubChem CID | 135759931 |
| Molecular Formula | C15H9BrF3NO2S |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | (E)-3-[(4-bromophenyl)iminomethyl]-1,1,1-trifluoro-4-hydroxy-4-thiophen-2-ylbut-3-en-2-one |
| SMILES | O=C(C(/C=N/c1ccc(Br)cc1)=C(/O)c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C15H9BrF3NO2S/c16-9-3-5-10(6-4-9)20-8-11(14(22)15(17,18)19)13(21)12-2-1-7-23-12/h1-8,21H/b13-11+,20-8+ |
| InChIKey | FPWHVNDNAHGYFY-AZFSQVTLSA-N |
| XLogP | 5.31 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|