C8H7F3O2S — CID 58914155
(Z)-2-deuterio-4,4,4-trifluoro-1-thiophen-2-ylbut-1-ene-1,3-diol (PubChem CID 58914155) has the molecular formula C8H7F3O2S and a molecular weight of 225.21 g/mol. Its IUPAC name is (Z)-2-deuterio-4,4,4-trifluoro-1-thiophen-2-ylbut-1-ene-1,3-diol.
| Compound Name | (Z)-2-deuterio-4,4,4-trifluoro-1-thiophen-2-ylbut-1-ene-1,3-diol |
|---|---|
| PubChem CID | 58914155 |
| Molecular Formula | C8H7F3O2S |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | (Z)-2-deuterio-4,4,4-trifluoro-1-thiophen-2-ylbut-1-ene-1,3-diol |
| SMILES | [2H]/C(=C(/O)c1cccs1)C(O)C(F)(F)F |
| InChI | InChI=1S/C8H7F3O2S/c9-8(10,11)7(13)4-5(12)6-2-1-3-14-6/h1-4,7,12-13H/b5-4-/i4D |
| InChIKey | PCGZWDUJVMFOKT-WIEMPLCCSA-N |
| XLogP | 2.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|