C27H20N4O7S — CID 135493450
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate (PubChem CID 135493450) has the molecular formula C27H20N4O7S and a molecular weight of 544.55 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 135493450 |
| Molecular Formula | C27H20N4O7S |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate |
| SMILES | [H]/N=C1/C(c2nc3ccccc3s2)=C(O)CN1c1cccc(C(=O)OCc2cc([N+](=O)[O-])cc3c2OCOC3)c1 |
| InChI | InChI=1S/C27H20N4O7S/c28-25-23(26-29-20-6-1-2-7-22(20)39-26)21(32)11-30(25)18-5-3-4-15(8-18)27(33)37-13-17-10-19(31(34)35)9-16-12-36-14-38-24(16)17/h1-10,28,32H,11-14H2/b28-25- |
| InChIKey | BUWLGBJEAHYFBX-FVDSYPCUSA-N |
| XLogP | 5.19 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|