C25H21N5O6S2 — CID 135535525
[2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 3-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate (PubChem CID 135535525) has the molecular formula C25H21N5O6S2 and a molecular weight of 551.61 g/mol. Its IUPAC name is [2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 3-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate.
| Compound Name | [2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 3-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 135535525 |
| Molecular Formula | C25H21N5O6S2 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | [2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 3-[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]benzoate |
| SMILES | [H]/N=C1/C(c2nc3ccccc3s2)=C(O)CN1c1cccc(C(=O)OCC(=O)NCCN2C(=O)CSC2=O)c1 |
| InChI | InChI=1S/C25H21N5O6S2/c26-22-21(23-28-16-6-1-2-7-18(16)38-23)17(31)11-30(22)15-5-3-4-14(10-15)24(34)36-12-19(32)27-8-9-29-20(33)13-37-25(29)35/h1-7,10,26,31H,8-9,11-13H2,(H,27,32)/b26-22- |
| InChIKey | RATLJIUJDBOYHT-ROMGYVFFSA-N |
| XLogP | 3.03 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|