C14H17N7O6 — CID 135497087
methyl 3-[[(2S)-3-methyl-2-[(5-nitro-1H-pyrazole-3-carbonyl)amino]butanoyl]amino]-1H-pyrazole-5-carboxylate (PubChem CID 135497087) has the molecular formula C14H17N7O6 and a molecular weight of 379.33 g/mol. Its IUPAC name is methyl 3-[[(2S)-3-methyl-2-[(5-nitro-1H-pyrazole-3-carbonyl)amino]butanoyl]amino]-1H-pyrazole-5-carboxylate.
| Compound Name | methyl 3-[[(2S)-3-methyl-2-[(5-nitro-1H-pyrazole-3-carbonyl)amino]butanoyl]amino]-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 135497087 |
| Molecular Formula | C14H17N7O6 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | methyl 3-[[(2S)-3-methyl-2-[(5-nitro-1H-pyrazole-3-carbonyl)amino]butanoyl]amino]-1H-pyrazole-5-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)[C@@H](NC(=O)c2cc([N+](=O)[O-])[nH]n2)C(C)C)n[nH]1 |
| InChI | InChI=1S/C14H17N7O6/c1-6(2)11(16-12(22)7-5-10(20-17-7)21(25)26)13(23)15-9-4-8(18-19-9)14(24)27-3/h4-6,11H,1-3H3,(H,16,22)(H,17,20)(H2,15,18,19,23)/t11-/m0/s1 |
| InChIKey | OFRSEOYUXBOIGH-NSHDSACASA-N |
| XLogP | 0.22 |
| TPSA | 185.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|