C14H15N3O3S2 — CID 135499453
(E)-2-[(2-amino-2-sulfanylideneethanethioyl)iminomethyl]-3-hydroxy-N-(2-methoxyphenyl)but-2-enamide (PubChem CID 135499453) has the molecular formula C14H15N3O3S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is (E)-2-[(2-amino-2-sulfanylideneethanethioyl)iminomethyl]-3-hydroxy-N-(2-methoxyphenyl)but-2-enamide.
| Compound Name | (E)-2-[(2-amino-2-sulfanylideneethanethioyl)iminomethyl]-3-hydroxy-N-(2-methoxyphenyl)but-2-enamide |
|---|---|
| PubChem CID | 135499453 |
| Molecular Formula | C14H15N3O3S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | (E)-2-[(2-amino-2-sulfanylideneethanethioyl)iminomethyl]-3-hydroxy-N-(2-methoxyphenyl)but-2-enamide |
| SMILES | COc1ccccc1NC(=O)C(/C=N/C(=S)C(N)=S)=C(\C)O |
| InChI | InChI=1S/C14H15N3O3S2/c1-8(18)9(7-16-14(22)12(15)21)13(19)17-10-5-3-4-6-11(10)20-2/h3-7,18H,1-2H3,(H2,15,21)(H,17,19)/b9-8+,16-7+ |
| InChIKey | XDGVSULBTHGGLV-QMZHZPTBSA-N |
| XLogP | 2.15 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|